Organic acids and derivatives
Filtered Search Results
Benzyl cyanoacetate, 97%
CAS: 14447-18-8 Molecular Formula: C10H9NO2 Molecular Weight (g/mol): 175.19 MDL Number: MFCD00051719 InChI Key: RCUIWQWWDLZNMS-UHFFFAOYSA-N Synonym: benzyl cyanoacetate,acetic acid, cyano-, phenylmethyl ester,cyanoacetic acid benzyl ester,benzyl-cyanoacetate,acetic acid, cyano-, benzyl ester,acmc-20alph,phenylmethyl 2-cyanoacetate,cyano-acetic acid benzyl ester,benzyl ester of cyanoacetic acid PubChem CID: 560818 IUPAC Name: benzyl 2-cyanoacetate SMILES: O=C(CC#N)OCC1=CC=CC=C1
| PubChem CID | 560818 |
|---|---|
| CAS | 14447-18-8 |
| Molecular Weight (g/mol) | 175.19 |
| MDL Number | MFCD00051719 |
| SMILES | O=C(CC#N)OCC1=CC=CC=C1 |
| Synonym | benzyl cyanoacetate,acetic acid, cyano-, phenylmethyl ester,cyanoacetic acid benzyl ester,benzyl-cyanoacetate,acetic acid, cyano-, benzyl ester,acmc-20alph,phenylmethyl 2-cyanoacetate,cyano-acetic acid benzyl ester,benzyl ester of cyanoacetic acid |
| IUPAC Name | benzyl 2-cyanoacetate |
| InChI Key | RCUIWQWWDLZNMS-UHFFFAOYSA-N |
| Molecular Formula | C10H9NO2 |
m-Tolylacetic acid, 97%
CAS: 621-36-3 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00004340 InChI Key: GJMPSRSMBJLKKB-UHFFFAOYSA-N Synonym: 3-methylphenylacetic acid,m-tolylacetic acid,2-m-tolyl acetic acid,2-3-methylphenyl acetic acid,3-tolylacetic acid,m-methylphenylacetic acid,3-methylphenyl acetic acid,m-tolylaceticacid,benzeneacetic acid, 3-methyl,methyll 3-methylphenylacetate PubChem CID: 12121 IUPAC Name: 2-(3-methylphenyl)acetic acid SMILES: CC1=CC=CC(CC(O)=O)=C1
| PubChem CID | 12121 |
|---|---|
| CAS | 621-36-3 |
| Molecular Weight (g/mol) | 150.18 |
| MDL Number | MFCD00004340 |
| SMILES | CC1=CC=CC(CC(O)=O)=C1 |
| Synonym | 3-methylphenylacetic acid,m-tolylacetic acid,2-m-tolyl acetic acid,2-3-methylphenyl acetic acid,3-tolylacetic acid,m-methylphenylacetic acid,3-methylphenyl acetic acid,m-tolylaceticacid,benzeneacetic acid, 3-methyl,methyll 3-methylphenylacetate |
| IUPAC Name | 2-(3-methylphenyl)acetic acid |
| InChI Key | GJMPSRSMBJLKKB-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
Ethyl tetradecanoate, 98%
CAS: 124-06-1 Molecular Formula: C16H32O2 Molecular Weight (g/mol): 256.43 MDL Number: MFCD00008984 InChI Key: MMKRHZKQPFCLLS-UHFFFAOYSA-N Synonym: ethyl myristate,tetradecanoic acid, ethyl ester,myristic acid ethyl ester,myristic acid, ethyl ester,ethylmyristate,ethyl n-tetradecanoate,ethyl myristate natural,fema no. 2445,tetradecanoic acid ethyl ester,ethyl ester tetradecanoic acid PubChem CID: 31283 ChEBI: CHEBI:84849 IUPAC Name: ethyl tetradecanoate SMILES: CCCCCCCCCCCCCC(=O)OCC
| PubChem CID | 31283 |
|---|---|
| CAS | 124-06-1 |
| Molecular Weight (g/mol) | 256.43 |
| ChEBI | CHEBI:84849 |
| MDL Number | MFCD00008984 |
| SMILES | CCCCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl myristate,tetradecanoic acid, ethyl ester,myristic acid ethyl ester,myristic acid, ethyl ester,ethylmyristate,ethyl n-tetradecanoate,ethyl myristate natural,fema no. 2445,tetradecanoic acid ethyl ester,ethyl ester tetradecanoic acid |
| IUPAC Name | ethyl tetradecanoate |
| InChI Key | MMKRHZKQPFCLLS-UHFFFAOYSA-N |
| Molecular Formula | C16H32O2 |
Ethyl phenylcyanoacetate, 98%
CAS: 4553-07-5 Molecular Formula: C11H11NO2 Molecular Weight (g/mol): 189.21 MDL Number: MFCD00001866 InChI Key: SXIRJEDGTAKGKU-UHFFFAOYNA-N Synonym: ethyl phenylcyanoacetate,phenylcyanoacetic acid ethyl ester,ethyl cyanophenylacetate,ethyl cyano phenyl acetate,ethyl alpha-cyanophenylacetate,ethyl alpha-cyano-alpha-phenylacetate,acetic acid, cyanophenyl-, ethyl ester,alpha-cyanobenzeneacetic acid, ethyl ester,benzeneacetic acid, alpha-cyano-, ethyl ester,benzeneacetic acid, .alpha.-cyano-, ethyl ester PubChem CID: 95298 ChEBI: CHEBI:51926 IUPAC Name: ethyl 2-cyano-2-phenylacetate SMILES: CCOC(=O)C(C#N)C1=CC=CC=C1
| PubChem CID | 95298 |
|---|---|
| CAS | 4553-07-5 |
| Molecular Weight (g/mol) | 189.21 |
| ChEBI | CHEBI:51926 |
| MDL Number | MFCD00001866 |
| SMILES | CCOC(=O)C(C#N)C1=CC=CC=C1 |
| Synonym | ethyl phenylcyanoacetate,phenylcyanoacetic acid ethyl ester,ethyl cyanophenylacetate,ethyl cyano phenyl acetate,ethyl alpha-cyanophenylacetate,ethyl alpha-cyano-alpha-phenylacetate,acetic acid, cyanophenyl-, ethyl ester,alpha-cyanobenzeneacetic acid, ethyl ester,benzeneacetic acid, alpha-cyano-, ethyl ester,benzeneacetic acid, .alpha.-cyano-, ethyl ester |
| IUPAC Name | ethyl 2-cyano-2-phenylacetate |
| InChI Key | SXIRJEDGTAKGKU-UHFFFAOYNA-N |
| Molecular Formula | C11H11NO2 |
Ethylene glycol-O,O'-bis(2-aminoethyl)-N,N,N',N'-tetraacetic acid, 0.5M aq. soln., pH 8.0, autoclaved
CAS: 67-42-5 Molecular Formula: C14H24N2O10 Molecular Weight (g/mol): 380.35 MDL Number: MFCD00004291 InChI Key: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC Name: 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| PubChem CID | 6207 |
|---|---|
| CAS | 67-42-5 |
| Molecular Weight (g/mol) | 380.35 |
| ChEBI | CHEBI:30740 |
| MDL Number | MFCD00004291 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O10 |
(+)-Dibenzoyl-D-tartaric acid, 98+%
CAS: 17026-42-5 Molecular Formula: C18H14O8 Molecular Weight (g/mol): 358.30 MDL Number: MFCD00063222 InChI Key: YONLFQNRGZXBBF-ZCWZLOQUNA-N Synonym: dibenzoyl-d-tartaric acid,+-dibenzoyl-d-tartaric acid,2s,3s-2,3-bis benzoyloxy succinic acid,d-dibenzoyl tartaric acid,butanedioic acid, 2,3-bis benzoyloxy-, 2s,3s,+-o,o-dibenzoyltartaric acid,2s,3s-+-dibenzoyltartaric acid,+-dibenzoyltartaric acid,+-dibenzoyl tartaric acid PubChem CID: 1550213 SMILES: OC(=O)[C@@H](OC(=O)C1=CC=CC=C1)[C@H](OC(=O)C1=CC=CC=C1)C(O)=O
| PubChem CID | 1550213 |
|---|---|
| CAS | 17026-42-5 |
| Molecular Weight (g/mol) | 358.30 |
| MDL Number | MFCD00063222 |
| SMILES | OC(=O)[C@@H](OC(=O)C1=CC=CC=C1)[C@H](OC(=O)C1=CC=CC=C1)C(O)=O |
| Synonym | dibenzoyl-d-tartaric acid,+-dibenzoyl-d-tartaric acid,2s,3s-2,3-bis benzoyloxy succinic acid,d-dibenzoyl tartaric acid,butanedioic acid, 2,3-bis benzoyloxy-, 2s,3s,+-o,o-dibenzoyltartaric acid,2s,3s-+-dibenzoyltartaric acid,+-dibenzoyltartaric acid,+-dibenzoyl tartaric acid |
| InChI Key | YONLFQNRGZXBBF-ZCWZLOQUNA-N |
| Molecular Formula | C18H14O8 |
Ethylenediaminetetraacetic Acid Tetrasodium Salt, Solution, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 64-02-8 Molecular Formula: C10H12N2Na4O8 Molecular Weight (g/mol): 380.17 InChI Key: UEUXEKPTXMALOB-UHFFFAOYSA-J IUPAC Name: tetrasodium 2-({2-[bis(carboxylatomethyl)amino]ethyl}(carboxylatomethyl)amino)acetate SMILES: [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| CAS | 64-02-8 |
|---|---|
| Molecular Weight (g/mol) | 380.17 |
| SMILES | [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| IUPAC Name | tetrasodium 2-({2-[bis(carboxylatomethyl)amino]ethyl}(carboxylatomethyl)amino)acetate |
| InChI Key | UEUXEKPTXMALOB-UHFFFAOYSA-J |
| Molecular Formula | C10H12N2Na4O8 |
BAPTA tetraethyl ester, 98+%
CAS: 73630-07-6 Molecular Formula: C30H40N2O10 Molecular Weight (g/mol): 588.654 MDL Number: MFCD00532663 InChI Key: OLXCPQDFHUCXBA-UHFFFAOYSA-N Synonym: bapta tetraethyl ester,tetraethyl 2,2',2,2'-ethane-1,2-diylbis oxy bis 2,1-phenylene bis azanetriyl tetraacetate,1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetic acid tetraethyl ester,tetraethyl 2,2',2,2'-ethane-1,2-diylbis oxy-2,1-phenylenenitrilo tetraacetate,2-2-2-2-bis 2-ethoxy-2-oxoethyl amino phenoxy ethoxy-n-2-ethoxy-2-oxoethyl anilino acetic acid ethyl ester,ethyl 2-2-2-2-bis 2-ethoxy-2-oxidanylidene-ethyl amino phenoxy ethoxy phenyl-2-ethoxy-2-oxidanylidene-ethyl amino ethanoate,ethyl 2-2-2-2-bis 2-ethoxy-2-oxoethyl amino phenoxy ethoxy-n-2-ethoxy-2-oxoethyl anilino acetate,ethyl 2-2-2-2-bis 2-ethoxy-2-oxoethyl amino phenoxy ethoxy phenyl 2-ethoxy-2-oxoethyl amino acetate PubChem CID: 339960 IUPAC Name: ethyl 2-[2-[2-[2-[bis(2-ethoxy-2-oxoethyl)amino]phenoxy]ethoxy]-N-(2-ethoxy-2-oxoethyl)anilino]acetate SMILES: CCOC(=O)CN(CC(=O)OCC)C1=CC=CC=C1OCCOC2=CC=CC=C2N(CC(=O)OCC)CC(=O)OCC
| PubChem CID | 339960 |
|---|---|
| CAS | 73630-07-6 |
| Molecular Weight (g/mol) | 588.654 |
| MDL Number | MFCD00532663 |
| SMILES | CCOC(=O)CN(CC(=O)OCC)C1=CC=CC=C1OCCOC2=CC=CC=C2N(CC(=O)OCC)CC(=O)OCC |
| Synonym | bapta tetraethyl ester,tetraethyl 2,2',2,2'-ethane-1,2-diylbis oxy bis 2,1-phenylene bis azanetriyl tetraacetate,1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetic acid tetraethyl ester,tetraethyl 2,2',2,2'-ethane-1,2-diylbis oxy-2,1-phenylenenitrilo tetraacetate,2-2-2-2-bis 2-ethoxy-2-oxoethyl amino phenoxy ethoxy-n-2-ethoxy-2-oxoethyl anilino acetic acid ethyl ester,ethyl 2-2-2-2-bis 2-ethoxy-2-oxidanylidene-ethyl amino phenoxy ethoxy phenyl-2-ethoxy-2-oxidanylidene-ethyl amino ethanoate,ethyl 2-2-2-2-bis 2-ethoxy-2-oxoethyl amino phenoxy ethoxy-n-2-ethoxy-2-oxoethyl anilino acetate,ethyl 2-2-2-2-bis 2-ethoxy-2-oxoethyl amino phenoxy ethoxy phenyl 2-ethoxy-2-oxoethyl amino acetate |
| IUPAC Name | ethyl 2-[2-[2-[2-[bis(2-ethoxy-2-oxoethyl)amino]phenoxy]ethoxy]-N-(2-ethoxy-2-oxoethyl)anilino]acetate |
| InChI Key | OLXCPQDFHUCXBA-UHFFFAOYSA-N |
| Molecular Formula | C30H40N2O10 |
EDTA, Dipotassium Salt Dihydrate, MP Biomedicals
CAS: 2001-94-7 Molecular Formula: C10H16K2N2O8 Molecular Weight (g/mol): 370.441 InChI Key: MGDKBCNOUDORNI-UHFFFAOYSA-N Synonym: dipotassium dihydrogen ethylenediaminetetraacetate PubChem CID: 87063472 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;potassium SMILES: C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.[K].[K]
| PubChem CID | 87063472 |
|---|---|
| CAS | 2001-94-7 |
| Molecular Weight (g/mol) | 370.441 |
| SMILES | C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.[K].[K] |
| Synonym | dipotassium dihydrogen ethylenediaminetetraacetate |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;potassium |
| InChI Key | MGDKBCNOUDORNI-UHFFFAOYSA-N |
| Molecular Formula | C10H16K2N2O8 |
Pyromellitic acid, 96%
CAS: 89-05-4 Molecular Formula: C10H6O8 Molecular Weight (g/mol): 254.15 MDL Number: MFCD00002471 InChI Key: CYIDZMCFTVVTJO-UHFFFAOYSA-N Synonym: pyromellitic acid,1,2,4,5-benzenetetracarboxylic acid,usaf xr-20,1,2,4,5-tetracarboxybenzene,unii-d9uxg2u6zu,1,2,4,5-benzene-tetracarboxylic acid,d9uxg2u6zu,pubchem21809,acmc-20ap78,1,4,5-tetracarboxybenzene PubChem CID: 6961 ChEBI: CHEBI:45165 IUPAC Name: benzene-1,2,4,5-tetracarboxylic acid SMILES: C1=C(C(=CC(=C1C(=O)O)C(=O)O)C(=O)O)C(=O)O
| PubChem CID | 6961 |
|---|---|
| CAS | 89-05-4 |
| Molecular Weight (g/mol) | 254.15 |
| ChEBI | CHEBI:45165 |
| MDL Number | MFCD00002471 |
| SMILES | C1=C(C(=CC(=C1C(=O)O)C(=O)O)C(=O)O)C(=O)O |
| Synonym | pyromellitic acid,1,2,4,5-benzenetetracarboxylic acid,usaf xr-20,1,2,4,5-tetracarboxybenzene,unii-d9uxg2u6zu,1,2,4,5-benzene-tetracarboxylic acid,d9uxg2u6zu,pubchem21809,acmc-20ap78,1,4,5-tetracarboxybenzene |
| IUPAC Name | benzene-1,2,4,5-tetracarboxylic acid |
| InChI Key | CYIDZMCFTVVTJO-UHFFFAOYSA-N |
| Molecular Formula | C10H6O8 |
(+)-Diacetyl-L-tartaric anhydride, 97%
CAS: 6283-74-5 Molecular Formula: C8H8O7 Molecular Weight (g/mol): 216.15 MDL Number: MFCD00037918 InChI Key: XAKITKDHDMPGPW-IOMOGOHMNA-N Synonym: 3r,4r-2,5-dioxotetrahydrofuran-3,4-diyl diacetate,unii-d7xnf76o0k,+-diacetyl-l-tartaric anhydride,d7xnf76o0k,2,5-furandione, 3,4-bis acetyloxy dihydro-, 3r,4r,3r,4r-4-acetyloxy-2,5-dioxooxolan-3-yl acetate,di-o-acetyl-l-tartaric anhydride,o,o-diacetyl tartaric acid anhydride,acetic acid 4-acetoxy-2,5-dioxo-tetrahydro-furan-3-yl ester,3r-trans-dihydro-2,5-dioxofuran-3,4-diyl diacetate PubChem CID: 513914 SMILES: CC(=O)O[C@@H]1[C@@H](OC(C)=O)C(=O)OC1=O
| PubChem CID | 513914 |
|---|---|
| CAS | 6283-74-5 |
| Molecular Weight (g/mol) | 216.15 |
| MDL Number | MFCD00037918 |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)C(=O)OC1=O |
| Synonym | 3r,4r-2,5-dioxotetrahydrofuran-3,4-diyl diacetate,unii-d7xnf76o0k,+-diacetyl-l-tartaric anhydride,d7xnf76o0k,2,5-furandione, 3,4-bis acetyloxy dihydro-, 3r,4r,3r,4r-4-acetyloxy-2,5-dioxooxolan-3-yl acetate,di-o-acetyl-l-tartaric anhydride,o,o-diacetyl tartaric acid anhydride,acetic acid 4-acetoxy-2,5-dioxo-tetrahydro-furan-3-yl ester,3r-trans-dihydro-2,5-dioxofuran-3,4-diyl diacetate |
| InChI Key | XAKITKDHDMPGPW-IOMOGOHMNA-N |
| Molecular Formula | C8H8O7 |
1,2,3,5-Tetra-O-benzoyl-2-C-methyl-beta-D-ribofuranose, 98%, Thermo Scientific Chemicals
CAS: 15397-15-6 Molecular Formula: C34H28O9 Molecular Weight (g/mol): 580.589 MDL Number: MFCD07369658 InChI Key: QJZSLTLDMBDKOU-VBHQRPIPSA-N Synonym: 1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-b-d-ribofuranose,2s,3r,4r,5r-5-benzoyloxy methyl-3-methyltetrahydrofuran-2,3,4-triyl tribenzoate,2s,3r,4r,5r-2,4-bis benzoyloxy-5-benzoyloxy methyl-3-methyloxolan-3-yl benzoate,1,2,3,5-tetra-o-benzoyl-2'-c-methyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d ribofuranose,2-c-methyl-beta-d-ribofuranose 1,2,3,5-tetrabenzoate,2-c-methyl-1,2,3,5-tetra-o-benzoyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d-ribofura PubChem CID: 10875560 IUPAC Name: [(2R,3R,4R,5S)-3,4,5-tribenzoyloxy-4-methyloxolan-2-yl]methyl benzoate SMILES: CC1(C(C(OC1OC(=O)C2=CC=CC=C2)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5
| PubChem CID | 10875560 |
|---|---|
| CAS | 15397-15-6 |
| Molecular Weight (g/mol) | 580.589 |
| MDL Number | MFCD07369658 |
| SMILES | CC1(C(C(OC1OC(=O)C2=CC=CC=C2)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
| Synonym | 1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-b-d-ribofuranose,2s,3r,4r,5r-5-benzoyloxy methyl-3-methyltetrahydrofuran-2,3,4-triyl tribenzoate,2s,3r,4r,5r-2,4-bis benzoyloxy-5-benzoyloxy methyl-3-methyloxolan-3-yl benzoate,1,2,3,5-tetra-o-benzoyl-2'-c-methyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d ribofuranose,2-c-methyl-beta-d-ribofuranose 1,2,3,5-tetrabenzoate,2-c-methyl-1,2,3,5-tetra-o-benzoyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d-ribofura |
| IUPAC Name | [(2R,3R,4R,5S)-3,4,5-tribenzoyloxy-4-methyloxolan-2-yl]methyl benzoate |
| InChI Key | QJZSLTLDMBDKOU-VBHQRPIPSA-N |
| Molecular Formula | C34H28O9 |
Edetate Disodium U.S.P., Macron Fine Chemicals™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Dess-Martin periodinane
CAS: 87413-09-0 Molecular Formula: C13H13IO8 Molecular Weight (g/mol): 424.14 MDL Number: MFCD00130127 InChI Key: NKLCNNUWBJBICK-UHFFFAOYSA-N PubChem CID: 159087 SMILES: CC(=O)O[I]1(OC(C)=O)(OC(C)=O)OC(=O)C2=CC=CC=C12
| PubChem CID | 159087 |
|---|---|
| CAS | 87413-09-0 |
| Molecular Weight (g/mol) | 424.14 |
| MDL Number | MFCD00130127 |
| SMILES | CC(=O)O[I]1(OC(C)=O)(OC(C)=O)OC(=O)C2=CC=CC=C12 |
| InChI Key | NKLCNNUWBJBICK-UHFFFAOYSA-N |
| Molecular Formula | C13H13IO8 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, Electrophoresis Grade, 99.4+%
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |